About 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine
1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 70512373) has the molecular formula C14H28N4
and a molecular weight of 252.41 g/mol. Its IUPAC name is 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| PubChem CID | 70512373 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)C(CCC(C)N)N1CC=CC=C1N |
| InChI | InChI=1S/C14H28N4/c1-4-17(5-2)14(10-9-12(3)15)18-11-7-6-8-13(18)16/h6-8,12,14H,4-5,9-11,15-16H2,1-3H3 |
| InChIKey | FJGSOQVILWYJKV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine?
The IUPAC name of 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine (CID 70512373) is 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine.
What is the SMILES notation for 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine?
The canonical SMILES for 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine is CCN(CC)C(CCC(C)N)N1CC=CC=C1N.
What is the InChIKey of 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine?
The InChIKey is FJGSOQVILWYJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4/c1-4-17(5-2)14(10-9-12(3)15)18-11-7-6-8-13(18)16/h6-8,12,14H,4-5,9-11,15-16H2,1-3H3.
What are the key properties of 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine?
1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine has a molecular weight of 252.41 g/mol, XLogP of 1.45, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2H-pyridin-1-yl)-1-N,1-N-diethylpentane-1,4-diamine is sourced from PubChem (CID 70512373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).