C18H32N2O3 — CID 70512424
1-ethyl-5-(10-methylundecyl)-1,3-diazinane-2,4,6-trione (PubChem CID 70512424) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-ethyl-5-(10-methylundecyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-ethyl-5-(10-methylundecyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70512424 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 1-ethyl-5-(10-methylundecyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)NC(=O)C(CCCCCCCCCC(C)C)C1=O |
| InChI | InChI=1S/C18H32N2O3/c1-4-20-17(22)15(16(21)19-18(20)23)13-11-9-7-5-6-8-10-12-14(2)3/h14-15H,4-13H2,1-3H3,(H,19,21,23) |
| InChIKey | PPCWNGNCHCMUJU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|