About 1H-purino[7,8-a]pyrimidine-2,4-dione
1H-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 70512426) has the molecular formula C8H5N5O2
and a molecular weight of 203.16 g/mol. Its IUPAC name is 1H-purino[7,8-a]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1H-purino[7,8-a]pyrimidine-2,4-dione |
| PubChem CID | 70512426 |
| Molecular Formula | C8H5N5O2 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1H-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2c(nc3ncccn32)[nH]1 |
| InChI | InChI=1S/C8H5N5O2/c14-6-4-5(11-8(15)12-6)10-7-9-2-1-3-13(4)7/h1-3H,(H2,11,12,14,15) |
| InChIKey | NOAAQDOMMURYCS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-purino[7,8-a]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-purino[7,8-a]pyrimidine-2,4-dione?
The IUPAC name of 1H-purino[7,8-a]pyrimidine-2,4-dione (CID 70512426) is 1H-purino[7,8-a]pyrimidine-2,4-dione.
What is the SMILES notation for 1H-purino[7,8-a]pyrimidine-2,4-dione?
The canonical SMILES for 1H-purino[7,8-a]pyrimidine-2,4-dione is O=c1[nH]c(=O)c2c(nc3ncccn32)[nH]1.
What is the InChIKey of 1H-purino[7,8-a]pyrimidine-2,4-dione?
The InChIKey is NOAAQDOMMURYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5O2/c14-6-4-5(11-8(15)12-6)10-7-9-2-1-3-13(4)7/h1-3H,(H2,11,12,14,15).
What are the key properties of 1H-purino[7,8-a]pyrimidine-2,4-dione?
1H-purino[7,8-a]pyrimidine-2,4-dione has a molecular weight of 203.16 g/mol, XLogP of -0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-purino[7,8-a]pyrimidine-2,4-dione is sourced from PubChem (CID 70512426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).