About [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate
[2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate (PubChem CID 70512452) has the molecular formula C10H9Cl2NO4S
and a molecular weight of 310.16 g/mol. Its IUPAC name is [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate |
| PubChem CID | 70512452 |
| Molecular Formula | C10H9Cl2NO4S |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate |
| SMILES | O=C(O)OC1CSC(c2cc(Cl)cc(Cl)c2O)N1 |
| InChI | InChI=1S/C10H9Cl2NO4S/c11-4-1-5(8(14)6(12)2-4)9-13-7(3-18-9)17-10(15)16/h1-2,7,9,13-14H,3H2,(H,15,16) |
| InChIKey | SLRZPNQHWGFHDD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate?
The IUPAC name of [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate (CID 70512452) is [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate.
What is the SMILES notation for [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate?
The canonical SMILES for [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate is O=C(O)OC1CSC(c2cc(Cl)cc(Cl)c2O)N1.
What is the InChIKey of [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate?
The InChIKey is SLRZPNQHWGFHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO4S/c11-4-1-5(8(14)6(12)2-4)9-13-7(3-18-9)17-10(15)16/h1-2,7,9,13-14H,3H2,(H,15,16).
What are the key properties of [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate?
[2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate has a molecular weight of 310.16 g/mol, XLogP of 3.05, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-dichloro-2-hydroxyphenyl)-1,3-thiazolidin-4-yl] hydrogen carbonate is sourced from PubChem (CID 70512452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).