About 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine
5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine (PubChem CID 70512497) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine |
| PubChem CID | 70512497 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine |
| SMILES | C=CCN1CC(c2ccccc2)CN=C1N |
| InChI | InChI=1S/C13H17N3/c1-2-8-16-10-12(9-15-13(16)14)11-6-4-3-5-7-11/h2-7,12H,1,8-10H2,(H2,14,15) |
| InChIKey | MVRXHRLDJABLBU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine?
The IUPAC name of 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine (CID 70512497) is 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine.
What is the SMILES notation for 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine?
The canonical SMILES for 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine is C=CCN1CC(c2ccccc2)CN=C1N.
What is the InChIKey of 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine?
The InChIKey is MVRXHRLDJABLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-2-8-16-10-12(9-15-13(16)14)11-6-4-3-5-7-11/h2-7,12H,1,8-10H2,(H2,14,15).
What are the key properties of 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine?
5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine has a molecular weight of 215.30 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1-prop-2-enyl-5,6-dihydro-4H-pyrimidin-2-amine is sourced from PubChem (CID 70512497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).