C22H35NO7 — CID 70512867
[(2S,3R,6E)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-nitrooxyethylidene)oxepan-3-yl] acetate (PubChem CID 70512867) has the molecular formula C22H35NO7 and a molecular weight of 425.52 g/mol. Its IUPAC name is [(2S,3R,6E)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-nitrooxyethylidene)oxepan-3-yl] acetate.
| Compound Name | [(2S,3R,6E)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-nitrooxyethylidene)oxepan-3-yl] acetate |
|---|---|
| PubChem CID | 70512867 |
| Molecular Formula | C22H35NO7 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | [(2S,3R,6E)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-nitrooxyethylidene)oxepan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC/C(=C\CO[N+](=O)[O-])CO[C@@]1(C)CCCC(C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C22H35NO7/c1-16(2)8-10-20(25)17(3)7-6-13-22(5)21(30-18(4)24)11-9-19(15-28-22)12-14-29-23(26)27/h8,12,17,21H,6-7,9-11,13-15H2,1-5H3/b19-12+/t17?,21-,22+/m1/s1 |
| InChIKey | ICBYWCULGUOXLP-IXFMJGBMSA-N |
| XLogP | 4.35 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|