C20H32O5 — CID 70513210
(2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid (PubChem CID 70513210) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid.
| Compound Name | (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 70513210 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetic acid |
| SMILES | CC(C)=CCC(O)C(C)CCC[C@]1(C)OC/C(=C/C(=O)O)CCC1=O |
| InChI | InChI=1S/C20H32O5/c1-14(2)7-9-17(21)15(3)6-5-11-20(4)18(22)10-8-16(13-25-20)12-19(23)24/h7,12,15,17,21H,5-6,8-11,13H2,1-4H3,(H,23,24)/b16-12+/t15?,17?,20-/m0/s1 |
| InChIKey | ZQHALBYHEGAMBI-LOSFCXHWSA-N |
| XLogP | 3.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|