About (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid
(2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid (PubChem CID 70513213) has the molecular formula C10H8Cl2N2O3
and a molecular weight of 275.09 g/mol. Its IUPAC name is (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid |
| PubChem CID | 70513213 |
| Molecular Formula | C10H8Cl2N2O3 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid |
| SMILES | C[C@@H](Nc1nc2cc(Cl)c(Cl)cc2o1)C(=O)O |
| InChI | InChI=1S/C10H8Cl2N2O3/c1-4(9(15)16)13-10-14-7-2-5(11)6(12)3-8(7)17-10/h2-4H,1H3,(H,13,14)(H,15,16)/t4-/m1/s1 |
| InChIKey | DAMUIIJVDIHVAB-SCSAIBSYSA-N |
| XLogP | 3.02 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid?
The IUPAC name of (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid (CID 70513213) is (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid.
What is the SMILES notation for (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid?
The canonical SMILES for (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid is C[C@@H](Nc1nc2cc(Cl)c(Cl)cc2o1)C(=O)O.
What is the InChIKey of (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid?
The InChIKey is DAMUIIJVDIHVAB-SCSAIBSYSA-N. The full InChI is InChI=1S/C10H8Cl2N2O3/c1-4(9(15)16)13-10-14-7-2-5(11)6(12)3-8(7)17-10/h2-4H,1H3,(H,13,14)(H,15,16)/t4-/m1/s1.
What are the key properties of (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid?
(2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid has a molecular weight of 275.09 g/mol, XLogP of 3.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]propanoic acid is sourced from PubChem (CID 70513213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).