About 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one
1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one (PubChem CID 70513834) has the molecular formula C15H11F3N4O
and a molecular weight of 320.27 g/mol. Its IUPAC name is 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one.
Molecular Properties
| Compound Name | 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one |
| PubChem CID | 70513834 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one |
| SMILES | Cn1cc(-c2cccc(C(F)(F)F)c2)c(=O)c(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C15H11F3N4O/c1-22-6-11(9-3-2-4-10(5-9)15(16,17)18)13(23)12(7-22)14-19-8-20-21-14/h2-8H,1H3,(H,19,20,21) |
| InChIKey | RQELOVXBXAVBCJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one?
The IUPAC name of 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one (CID 70513834) is 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one.
What is the SMILES notation for 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one?
The canonical SMILES for 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is Cn1cc(-c2cccc(C(F)(F)F)c2)c(=O)c(-c2ncn[nH]2)c1.
What is the InChIKey of 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one?
The InChIKey is RQELOVXBXAVBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N4O/c1-22-6-11(9-3-2-4-10(5-9)15(16,17)18)13(23)12(7-22)14-19-8-20-21-14/h2-8H,1H3,(H,19,20,21).
What are the key properties of 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one?
1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one has a molecular weight of 320.27 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1H-1,2,4-triazol-5-yl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is sourced from PubChem (CID 70513834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).