C25H40O6 — CID 70513942
[(2E)-2-[(6R,7S)-6-acetyloxy-7-methyl-7-(4,7,8-trimethyl-5-oxonon-7-enyl)oxepan-3-ylidene]ethyl] acetate (PubChem CID 70513942) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(2E)-2-[(6R,7S)-6-acetyloxy-7-methyl-7-(4,7,8-trimethyl-5-oxonon-7-enyl)oxepan-3-ylidene]ethyl] acetate.
| Compound Name | [(2E)-2-[(6R,7S)-6-acetyloxy-7-methyl-7-(4,7,8-trimethyl-5-oxonon-7-enyl)oxepan-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 70513942 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(2E)-2-[(6R,7S)-6-acetyloxy-7-methyl-7-(4,7,8-trimethyl-5-oxonon-7-enyl)oxepan-3-ylidene]ethyl] acetate |
| SMILES | CC(=O)OC/C=C1\CC[C@@H](OC(C)=O)[C@](C)(CCCC(C)C(=O)CC(C)=C(C)C)OC1 |
| InChI | InChI=1S/C25H40O6/c1-17(2)19(4)15-23(28)18(3)9-8-13-25(7)24(31-21(6)27)11-10-22(16-30-25)12-14-29-20(5)26/h12,18,24H,8-11,13-16H2,1-7H3/b22-12+/t18?,24-,25+/m1/s1 |
| InChIKey | DTOOWKXDJQFIHB-JYAQTJBISA-N |
| XLogP | 5.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|