C19H35FO2 — CID 70514218
(1S,2R,3R)-2-(6-fluoroheptyl)-3-(3-hydroxyhept-1-enyl)cyclopentan-1-ol (PubChem CID 70514218) has the molecular formula C19H35FO2 and a molecular weight of 314.49 g/mol. Its IUPAC name is (1S,2R,3R)-2-(6-fluoroheptyl)-3-(3-hydroxyhept-1-enyl)cyclopentan-1-ol.
| Compound Name | (1S,2R,3R)-2-(6-fluoroheptyl)-3-(3-hydroxyhept-1-enyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 70514218 |
| Molecular Formula | C19H35FO2 |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (1S,2R,3R)-2-(6-fluoroheptyl)-3-(3-hydroxyhept-1-enyl)cyclopentan-1-ol |
| SMILES | CCCCC(O)C=C[C@H]1CC[C@H](O)[C@@H]1CCCCCC(C)F |
| InChI | InChI=1S/C19H35FO2/c1-3-4-9-17(21)13-11-16-12-14-19(22)18(16)10-7-5-6-8-15(2)20/h11,13,15-19,21-22H,3-10,12,14H2,1-2H3/t15?,16-,17?,18+,19-/m0/s1 |
| InChIKey | JCLVHWAYXFZDTQ-NQEVIQBJSA-N |
| XLogP | 4.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|