About dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate
dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate (PubChem CID 70514513) has the molecular formula C10H12K2O7S
and a molecular weight of 354.46 g/mol. Its IUPAC name is dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate.
Molecular Properties
| Compound Name | dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate |
| PubChem CID | 70514513 |
| Molecular Formula | C10H12K2O7S |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate |
| SMILES | Cc1ccc(C(C)C(=O)O)c(O)c1.O=S(=O)([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C10H12O3.2K.H2O4S/c1-6-3-4-8(9(11)5-6)7(2)10(12)13;;;1-5(2,3)4/h3-5,7,11H,1-2H3,(H,12,13);;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | FSKKWNMNSXJPKS-UHFFFAOYSA-L |
| XLogP | -5.44 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate?
The IUPAC name of dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate (CID 70514513) is dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate.
What is the SMILES notation for dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate?
The canonical SMILES for dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate is Cc1ccc(C(C)C(=O)O)c(O)c1.O=S(=O)([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate?
The InChIKey is FSKKWNMNSXJPKS-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H12O3.2K.H2O4S/c1-6-3-4-8(9(11)5-6)7(2)10(12)13;;;1-5(2,3)4/h3-5,7,11H,1-2H3,(H,12,13);;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate?
dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate has a molecular weight of 354.46 g/mol, XLogP of -5.44, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-(2-hydroxy-4-methylphenyl)propanoic acid;sulfate is sourced from PubChem (CID 70514513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).