About ethyl 3-(ethylamino)but-2-enoate;morpholine
ethyl 3-(ethylamino)but-2-enoate;morpholine (PubChem CID 70514662) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is ethyl 3-(ethylamino)but-2-enoate;morpholine.
Molecular Properties
| Compound Name | ethyl 3-(ethylamino)but-2-enoate;morpholine |
| PubChem CID | 70514662 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethyl 3-(ethylamino)but-2-enoate;morpholine |
| SMILES | C1COCCN1.CCNC(C)=CC(=O)OCC |
| InChI | InChI=1S/C8H15NO2.C4H9NO/c1-4-9-7(3)6-8(10)11-5-2;1-3-6-4-2-5-1/h6,9H,4-5H2,1-3H3;5H,1-4H2 |
| InChIKey | XNSPHVCROSNQFN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(ethylamino)but-2-enoate;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(ethylamino)but-2-enoate;morpholine?
The IUPAC name of ethyl 3-(ethylamino)but-2-enoate;morpholine (CID 70514662) is ethyl 3-(ethylamino)but-2-enoate;morpholine.
What is the SMILES notation for ethyl 3-(ethylamino)but-2-enoate;morpholine?
The canonical SMILES for ethyl 3-(ethylamino)but-2-enoate;morpholine is C1COCCN1.CCNC(C)=CC(=O)OCC.
What is the InChIKey of ethyl 3-(ethylamino)but-2-enoate;morpholine?
The InChIKey is XNSPHVCROSNQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C4H9NO/c1-4-9-7(3)6-8(10)11-5-2;1-3-6-4-2-5-1/h6,9H,4-5H2,1-3H3;5H,1-4H2.
What are the key properties of ethyl 3-(ethylamino)but-2-enoate;morpholine?
ethyl 3-(ethylamino)but-2-enoate;morpholine has a molecular weight of 244.33 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(ethylamino)but-2-enoate;morpholine is sourced from PubChem (CID 70514662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).