C25H40O7 — CID 70514952
methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]acetate (PubChem CID 70514952) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]acetate |
|---|---|
| PubChem CID | 70514952 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | methyl (2E)-2-[(6R,7S)-6-acetyloxy-7-(5-acetyloxy-4,8-dimethylnon-7-enyl)-7-methyloxepan-3-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@@H](OC(C)=O)[C@](C)(CCCC(C)C(CC=C(C)C)OC(C)=O)OC1 |
| InChI | InChI=1S/C25H40O7/c1-17(2)10-12-22(31-19(4)26)18(3)9-8-14-25(6)23(32-20(5)27)13-11-21(16-30-25)15-24(28)29-7/h10,15,18,22-23H,8-9,11-14,16H2,1-7H3/b21-15+/t18?,22?,23-,25+/m1/s1 |
| InChIKey | PDZDMSOHDSYHHH-ARAMJELZSA-N |
| XLogP | 4.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|