C17H15Cl3N2O4S — CID 70514970
N'-[2-chloro-5-(2,3-dichloro-4-methoxybenzoyl)phenyl]sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 70514970) has the molecular formula C17H15Cl3N2O4S and a molecular weight of 449.74 g/mol. Its IUPAC name is N'-[2-chloro-5-(2,3-dichloro-4-methoxybenzoyl)phenyl]sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-chloro-5-(2,3-dichloro-4-methoxybenzoyl)phenyl]sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 70514970 |
| Molecular Formula | C17H15Cl3N2O4S |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | N'-[2-chloro-5-(2,3-dichloro-4-methoxybenzoyl)phenyl]sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)c(S(=O)(=O)N=CN(C)C)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H15Cl3N2O4S/c1-22(2)9-21-27(24,25)14-8-10(4-6-12(14)18)17(23)11-5-7-13(26-3)16(20)15(11)19/h4-9H,1-3H3 |
| InChIKey | DDOCKRPKXJQBPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|