C21H32O8 — CID 70515106
2,2-dimethyl-3-[3,3,3-tris(3-oxobutoxy)prop-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 70515106) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is 2,2-dimethyl-3-[3,3,3-tris(3-oxobutoxy)prop-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-[3,3,3-tris(3-oxobutoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70515106 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2,2-dimethyl-3-[3,3,3-tris(3-oxobutoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(=O)CCOC(C=CC1C(C(=O)O)C1(C)C)(OCCC(C)=O)OCCC(C)=O |
| InChI | InChI=1S/C21H32O8/c1-14(22)7-11-27-21(28-12-8-15(2)23,29-13-9-16(3)24)10-6-17-18(19(25)26)20(17,4)5/h6,10,17-18H,7-9,11-13H2,1-5H3,(H,25,26) |
| InChIKey | VBIABBJEABXWCK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|