About (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone
(5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone (PubChem CID 70515285) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone |
| PubChem CID | 70515285 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1c2ccccc2CC(O)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O2/c23-19-14-15-8-2-4-10-17(15)22(18-11-5-3-9-16(18)19)20(24)21-12-6-1-7-13-21/h2-5,8-11,19,23H,1,6-7,12-14H2 |
| InChIKey | OITDUSPUAQHBOI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone?
The IUPAC name of (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone (CID 70515285) is (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone is O=C(N1CCCCC1)N1c2ccccc2CC(O)c2ccccc21.
What is the InChIKey of (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone?
The InChIKey is OITDUSPUAQHBOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2/c23-19-14-15-8-2-4-10-17(15)22(18-11-5-3-9-16(18)19)20(24)21-12-6-1-7-13-21/h2-5,8-11,19,23H,1,6-7,12-14H2.
What are the key properties of (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone?
(5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone has a molecular weight of 322.41 g/mol, XLogP of 4.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 70515285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).