About 2-methyl-3,4-dipropylaniline
2-methyl-3,4-dipropylaniline (PubChem CID 70515438) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-methyl-3,4-dipropylaniline.
Molecular Properties
| Compound Name | 2-methyl-3,4-dipropylaniline |
| PubChem CID | 70515438 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-methyl-3,4-dipropylaniline |
| SMILES | CCCc1ccc(N)c(C)c1CCC |
| InChI | InChI=1S/C13H21N/c1-4-6-11-8-9-13(14)10(3)12(11)7-5-2/h8-9H,4-7,14H2,1-3H3 |
| InChIKey | VVIDNJYKPPJOJW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,4-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dipropylaniline?
The IUPAC name of 2-methyl-3,4-dipropylaniline (CID 70515438) is 2-methyl-3,4-dipropylaniline.
What is the SMILES notation for 2-methyl-3,4-dipropylaniline?
The canonical SMILES for 2-methyl-3,4-dipropylaniline is CCCc1ccc(N)c(C)c1CCC.
What is the InChIKey of 2-methyl-3,4-dipropylaniline?
The InChIKey is VVIDNJYKPPJOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-4-6-11-8-9-13(14)10(3)12(11)7-5-2/h8-9H,4-7,14H2,1-3H3.
What are the key properties of 2-methyl-3,4-dipropylaniline?
2-methyl-3,4-dipropylaniline has a molecular weight of 191.32 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dipropylaniline is sourced from PubChem (CID 70515438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).