C21H31N3O — CID 70515514
1-[1-[3-(butylamino)propyl]-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 70515514) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[1-[3-(butylamino)propyl]-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 1-[1-[3-(butylamino)propyl]-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 70515514 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 1-[1-[3-(butylamino)propyl]-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | CCCCNCCCC1c2c(c3ccccc3n2C)CCN1C(C)=O |
| InChI | InChI=1S/C21H31N3O/c1-4-5-13-22-14-8-11-20-21-18(12-15-24(20)16(2)25)17-9-6-7-10-19(17)23(21)3/h6-7,9-10,20,22H,4-5,8,11-15H2,1-3H3 |
| InChIKey | CSFPDCKBANSIDY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|