About 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole
5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole (PubChem CID 70515564) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole |
| PubChem CID | 70515564 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole |
| SMILES | Cc1ccc(C2=CCNN2)cc1 |
| InChI | InChI=1S/C10H12N2/c1-8-2-4-9(5-3-8)10-6-7-11-12-10/h2-6,11-12H,7H2,1H3 |
| InChIKey | OSKIFXGALMCAGH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole?
The IUPAC name of 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole (CID 70515564) is 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole.
What is the SMILES notation for 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole?
The canonical SMILES for 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole is Cc1ccc(C2=CCNN2)cc1.
What is the InChIKey of 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole?
The InChIKey is OSKIFXGALMCAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-8-2-4-9(5-3-8)10-6-7-11-12-10/h2-6,11-12H,7H2,1H3.
What are the key properties of 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole?
5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole has a molecular weight of 160.22 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)-2,3-dihydro-1H-pyrazole is sourced from PubChem (CID 70515564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).