About [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate
[4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate (PubChem CID 70515702) has the molecular formula C10H16N4O3S
and a molecular weight of 272.33 g/mol. Its IUPAC name is [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate |
| PubChem CID | 70515702 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate |
| SMILES | CSCc1nn(C)c(OC(=O)N(C)C)c1C(N)=O |
| InChI | InChI=1S/C10H16N4O3S/c1-13(2)10(16)17-9-7(8(11)15)6(5-18-4)12-14(9)3/h5H2,1-4H3,(H2,11,15) |
| InChIKey | BPQBZGZNCNVHOD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate?
The IUPAC name of [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate (CID 70515702) is [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate?
The canonical SMILES for [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate is CSCc1nn(C)c(OC(=O)N(C)C)c1C(N)=O.
What is the InChIKey of [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate?
The InChIKey is BPQBZGZNCNVHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3S/c1-13(2)10(16)17-9-7(8(11)15)6(5-18-4)12-14(9)3/h5H2,1-4H3,(H2,11,15).
What are the key properties of [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate?
[4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate has a molecular weight of 272.33 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-carbamoyl-1-methyl-3-(methylsulfanylmethyl)pyrazol-5-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 70515702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).