About (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione
(7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione (PubChem CID 70515730) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione.
Molecular Properties
| Compound Name | (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione |
| PubChem CID | 70515730 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione |
| SMILES | CC(C)[C@@H]1C(=O)N2C1CCC(=O)C2(C)C |
| InChI | InChI=1S/C12H19NO2/c1-7(2)10-8-5-6-9(14)12(3,4)13(8)11(10)15/h7-8,10H,5-6H2,1-4H3/t8?,10-/m0/s1 |
| InChIKey | DDZZIGIQNPBIIQ-HTLJXXAVSA-N |
| XLogP | 1.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione?
The IUPAC name of (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione (CID 70515730) is (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione.
What is the SMILES notation for (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione?
The canonical SMILES for (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione is CC(C)[C@@H]1C(=O)N2C1CCC(=O)C2(C)C.
What is the InChIKey of (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione?
The InChIKey is DDZZIGIQNPBIIQ-HTLJXXAVSA-N. The full InChI is InChI=1S/C12H19NO2/c1-7(2)10-8-5-6-9(14)12(3,4)13(8)11(10)15/h7-8,10H,5-6H2,1-4H3/t8?,10-/m0/s1.
What are the key properties of (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione?
(7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione has a molecular weight of 209.29 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-2,2-dimethyl-7-propan-2-yl-1-azabicyclo[4.2.0]octane-3,8-dione is sourced from PubChem (CID 70515730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).