C31H54O7 — CID 70515880
7-[(1S,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid (PubChem CID 70515880) has the molecular formula C31H54O7 and a molecular weight of 538.77 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid.
| Compound Name | 7-[(1S,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid |
|---|---|
| PubChem CID | 70515880 |
| Molecular Formula | C31H54O7 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | 7-[(1S,2S)-2-[(E)-4-methyl-4-propoxypent-1-enyl]cyclopentyl]-2,2-bis(oxan-2-yloxy)heptanoic acid |
| SMILES | CCCOC(C)(C)C/C=C/[C@H]1CCC[C@@H]1CCCCCC(OC1CCCCO1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C31H54O7/c1-4-22-36-30(2,3)20-13-17-26-16-12-15-25(26)14-6-5-9-21-31(29(32)33,37-27-18-7-10-23-34-27)38-28-19-8-11-24-35-28/h13,17,25-28H,4-12,14-16,18-24H2,1-3H3,(H,32,33)/b17-13+/t25-,26+,27?,28?,31?/m0/s1 |
| InChIKey | BGHUMNPTHITFLU-NLROLVBFSA-N |
| XLogP | 7.37 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|