About 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid
7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 70515881) has the molecular formula C16H14FN3O3S
and a molecular weight of 347.37 g/mol. Its IUPAC name is 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| PubChem CID | 70515881 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | CCc1c(-c2csc(CN)n2)c(F)cc2c(=O)c(C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C16H14FN3O3S/c1-2-7-13(11-6-24-12(4-18)20-11)10(17)3-8-14(7)19-5-9(15(8)21)16(22)23/h3,5-6H,2,4,18H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | UCUBRBWVYKJOQV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid?
The IUPAC name of 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid (CID 70515881) is 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid.
What is the SMILES notation for 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid?
The canonical SMILES for 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid is CCc1c(-c2csc(CN)n2)c(F)cc2c(=O)c(C(=O)O)c[nH]c12.
What is the InChIKey of 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid?
The InChIKey is UCUBRBWVYKJOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FN3O3S/c1-2-7-13(11-6-24-12(4-18)20-11)10(17)3-8-14(7)19-5-9(15(8)21)16(22)23/h3,5-6H,2,4,18H2,1H3,(H,19,21)(H,22,23).
What are the key properties of 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid?
7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid has a molecular weight of 347.37 g/mol, XLogP of 2.51, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-8-ethyl-6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid is sourced from PubChem (CID 70515881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).