C26H42O7 — CID 70516304
5-[(3aR,4R,6aR)-2-methoxy-4-[(E)-oct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-yl]-5-(oxan-2-yloxy)pentanoic acid (PubChem CID 70516304) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is 5-[(3aR,4R,6aR)-2-methoxy-4-[(E)-oct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-yl]-5-(oxan-2-yloxy)pentanoic acid.
| Compound Name | 5-[(3aR,4R,6aR)-2-methoxy-4-[(E)-oct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-yl]-5-(oxan-2-yloxy)pentanoic acid |
|---|---|
| PubChem CID | 70516304 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 5-[(3aR,4R,6aR)-2-methoxy-4-[(E)-oct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-yl]-5-(oxan-2-yloxy)pentanoic acid |
| SMILES | CCCCCC/C=C/[C@H]1C(=O)C[C@H]2OC(OC)(C(CCCC(=O)O)OC3CCCCO3)C[C@@H]21 |
| InChI | InChI=1S/C26H42O7/c1-3-4-5-6-7-8-12-19-20-18-26(30-2,33-22(20)17-21(19)27)23(13-11-14-24(28)29)32-25-15-9-10-16-31-25/h8,12,19-20,22-23,25H,3-7,9-11,13-18H2,1-2H3,(H,28,29)/b12-8+/t19-,20-,22-,23?,25?,26?/m1/s1 |
| InChIKey | BXQKNVKZSZKVEZ-YGBMWDLLSA-N |
| XLogP | 5.02 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|