About [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate
[5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate (PubChem CID 70516529) has the molecular formula C19H25N3O4
and a molecular weight of 359.43 g/mol. Its IUPAC name is [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate.
Molecular Properties
| Compound Name | [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate |
| PubChem CID | 70516529 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate |
| SMILES | COc1ccc(-c2ccc(OC(=O)NCCCN(C)C)nc2)cc1OC |
| InChI | InChI=1S/C19H25N3O4/c1-22(2)11-5-10-20-19(23)26-18-9-7-15(13-21-18)14-6-8-16(24-3)17(12-14)25-4/h6-9,12-13H,5,10-11H2,1-4H3,(H,20,23) |
| InChIKey | DNWTUYJBTUHVSQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate?
The IUPAC name of [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate (CID 70516529) is [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate.
What is the SMILES notation for [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate?
The canonical SMILES for [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate is COc1ccc(-c2ccc(OC(=O)NCCCN(C)C)nc2)cc1OC.
What is the InChIKey of [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate?
The InChIKey is DNWTUYJBTUHVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O4/c1-22(2)11-5-10-20-19(23)26-18-9-7-15(13-21-18)14-6-8-16(24-3)17(12-14)25-4/h6-9,12-13H,5,10-11H2,1-4H3,(H,20,23).
What are the key properties of [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate?
[5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate has a molecular weight of 359.43 g/mol, XLogP of 2.81, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,4-dimethoxyphenyl)-2-pyridinyl] N-[3-(dimethylamino)propyl]carbamate is sourced from PubChem (CID 70516529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).