C12H18F3N5O2 — CID 70516588
methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate (PubChem CID 70516588) has the molecular formula C12H18F3N5O2 and a molecular weight of 321.30 g/mol. Its IUPAC name is methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate.
| Compound Name | methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 70516588 |
| Molecular Formula | C12H18F3N5O2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N5O2/c1-22-10(21)4-2-3-6-20-7-5-9(19-20)18-11(16)17-8-12(13,14)15/h5,7H,2-4,6,8H2,1H3,(H3,16,17,18,19) |
| InChIKey | DDGANAGZXIYTNX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|