C40H41FO3Si — CID 70516599
tert-butyl-[(2R,3S,4S)-3-[(E)-2-[2-(4-fluorophenyl)naphthalen-1-yl]ethenyl]-2-methoxyoxan-4-yl]oxy-diphenylsilane (PubChem CID 70516599) has the molecular formula C40H41FO3Si and a molecular weight of 616.85 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4S)-3-[(E)-2-[2-(4-fluorophenyl)naphthalen-1-yl]ethenyl]-2-methoxyoxan-4-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S,4S)-3-[(E)-2-[2-(4-fluorophenyl)naphthalen-1-yl]ethenyl]-2-methoxyoxan-4-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 70516599 |
| Molecular Formula | C40H41FO3Si |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | tert-butyl-[(2R,3S,4S)-3-[(E)-2-[2-(4-fluorophenyl)naphthalen-1-yl]ethenyl]-2-methoxyoxan-4-yl]oxy-diphenylsilane |
| SMILES | CO[C@@H]1OCC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1/C=C/c1c(-c2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C40H41FO3Si/c1-40(2,3)45(32-14-7-5-8-15-32,33-16-9-6-10-17-33)44-38-27-28-43-39(42-4)37(38)26-25-36-34-18-12-11-13-29(34)21-24-35(36)30-19-22-31(41)23-20-30/h5-26,37-39H,27-28H2,1-4H3/b26-25+/t37-,38-,39+/m0/s1 |
| InChIKey | RWZAXSXSBFCUBO-GIMOBZHISA-N |
| XLogP | 8.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|