C16H15NO — CID 70516707
2-[2-(4-methoxyphenyl)ethyl]benzonitrile (PubChem CID 70516707) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]benzonitrile.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]benzonitrile |
|---|---|
| PubChem CID | 70516707 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]benzonitrile |
| SMILES | COc1ccc(CCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C16H15NO/c1-18-16-10-7-13(8-11-16)6-9-14-4-2-3-5-15(14)12-17/h2-5,7-8,10-11H,6,9H2,1H3 |
| InChIKey | GBHJSIPHZJUCIE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |