About 1H-pyridine-2,2-diamine
1H-pyridine-2,2-diamine (PubChem CID 70517398) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 1H-pyridine-2,2-diamine.
Molecular Properties
| Compound Name | 1H-pyridine-2,2-diamine |
| PubChem CID | 70517398 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1H-pyridine-2,2-diamine |
| SMILES | NC1(N)C=CC=CN1 |
| InChI | InChI=1S/C5H9N3/c6-5(7)3-1-2-4-8-5/h1-4,8H,6-7H2 |
| InChIKey | SRICROQPOLNYOO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyridine-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyridine-2,2-diamine?
The IUPAC name of 1H-pyridine-2,2-diamine (CID 70517398) is 1H-pyridine-2,2-diamine.
What is the SMILES notation for 1H-pyridine-2,2-diamine?
The canonical SMILES for 1H-pyridine-2,2-diamine is NC1(N)C=CC=CN1.
What is the InChIKey of 1H-pyridine-2,2-diamine?
The InChIKey is SRICROQPOLNYOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c6-5(7)3-1-2-4-8-5/h1-4,8H,6-7H2.
What are the key properties of 1H-pyridine-2,2-diamine?
1H-pyridine-2,2-diamine has a molecular weight of 111.15 g/mol, XLogP of -0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyridine-2,2-diamine is sourced from PubChem (CID 70517398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).