C26H30O12 — CID 70517593
1-O,4-O-bis(3-but-2-enoyloxy-2-hydroxypropyl) 2-O-prop-2-enyl benzene-1,2,4-tricarboxylate (PubChem CID 70517593) has the molecular formula C26H30O12 and a molecular weight of 534.51 g/mol. Its IUPAC name is 1-O,4-O-bis(3-but-2-enoyloxy-2-hydroxypropyl) 2-O-prop-2-enyl benzene-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-bis(3-but-2-enoyloxy-2-hydroxypropyl) 2-O-prop-2-enyl benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 70517593 |
| Molecular Formula | C26H30O12 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 1-O,4-O-bis(3-but-2-enoyloxy-2-hydroxypropyl) 2-O-prop-2-enyl benzene-1,2,4-tricarboxylate |
| SMILES | C=CCOC(=O)c1cc(C(=O)OCC(O)COC(=O)C=CC)ccc1C(=O)OCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C26H30O12/c1-4-7-22(29)35-13-18(27)15-37-24(31)17-9-10-20(21(12-17)26(33)34-11-6-3)25(32)38-16-19(28)14-36-23(30)8-5-2/h4-10,12,18-19,27-28H,3,11,13-16H2,1-2H3 |
| InChIKey | PJPNZUAVERADQK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|