C11H11NS — CID 70517627
1,3,4,4a-tetrahydrothiopyrano[4,3-b]indole (PubChem CID 70517627) has the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. Its IUPAC name is 1,3,4,4a-tetrahydrothiopyrano[4,3-b]indole.
| Compound Name | 1,3,4,4a-tetrahydrothiopyrano[4,3-b]indole |
|---|---|
| PubChem CID | 70517627 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,3,4,4a-tetrahydrothiopyrano[4,3-b]indole |
| SMILES | c1ccc2c(c1)=NC1CCSCC=21 |
| InChI | InChI=1S/C11H11NS/c1-2-4-10-8(3-1)9-7-13-6-5-11(9)12-10/h1-4,11H,5-7H2 |
| InChIKey | SYOXTEVSDPITPE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |