C25H35FO7 — CID 70518010
[2-[(8S,9R,10S,13S,14S,17R)-9-fluoro-11-hydroxy-17-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70518010) has the molecular formula C25H35FO7 and a molecular weight of 466.55 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-9-fluoro-11-hydroxy-17-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-9-fluoro-11-hydroxy-17-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70518010 |
| Molecular Formula | C25H35FO7 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-9-fluoro-11-hydroxy-17-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | COCO[C@]1(C(=O)COC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C25H35FO7/c1-15(27)32-13-21(30)24(33-14-31-4)10-8-18-19-6-5-16-11-17(28)7-9-22(16,2)25(19,26)20(29)12-23(18,24)3/h11,18-20,29H,5-10,12-14H2,1-4H3/t18-,19-,20?,22-,23-,24-,25-/m0/s1 |
| InChIKey | VKKYESVPWPMAKQ-RFSHAOBYSA-N |
| XLogP | 3.07 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|