About 1-bromo-3-chlorobenzene;chlorobenzene
1-bromo-3-chlorobenzene;chlorobenzene (PubChem CID 70518060) has the molecular formula C12H9BrCl2
and a molecular weight of 304.01 g/mol. Its IUPAC name is 1-bromo-3-chlorobenzene;chlorobenzene.
Molecular Properties
| Compound Name | 1-bromo-3-chlorobenzene;chlorobenzene |
| PubChem CID | 70518060 |
| Molecular Formula | C12H9BrCl2 |
| Molecular Weight | 304.01 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | 1-bromo-3-chlorobenzene;chlorobenzene |
| SMILES | Clc1cccc(Br)c1.Clc1ccccc1 |
| InChI | InChI=1S/C6H4BrCl.C6H5Cl/c7-5-2-1-3-6(8)4-5;7-6-4-2-1-3-5-6/h1-4H;1-5H |
| InChIKey | YMMCMKLECVBGBS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.01 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-chlorobenzene;chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-chlorobenzene;chlorobenzene?
The IUPAC name of 1-bromo-3-chlorobenzene;chlorobenzene (CID 70518060) is 1-bromo-3-chlorobenzene;chlorobenzene.
What is the SMILES notation for 1-bromo-3-chlorobenzene;chlorobenzene?
The canonical SMILES for 1-bromo-3-chlorobenzene;chlorobenzene is Clc1cccc(Br)c1.Clc1ccccc1.
What is the InChIKey of 1-bromo-3-chlorobenzene;chlorobenzene?
The InChIKey is YMMCMKLECVBGBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrCl.C6H5Cl/c7-5-2-1-3-6(8)4-5;7-6-4-2-1-3-5-6/h1-4H;1-5H.
What are the key properties of 1-bromo-3-chlorobenzene;chlorobenzene?
1-bromo-3-chlorobenzene;chlorobenzene has a molecular weight of 304.01 g/mol, XLogP of 5.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-chlorobenzene;chlorobenzene is sourced from PubChem (CID 70518060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).