C27H28F3N3O2 — CID 7051807
(1R,9S)-11-[[4-(dimethylamino)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 7051807) has the molecular formula C27H28F3N3O2 and a molecular weight of 483.53 g/mol. Its IUPAC name is (1R,9S)-11-[[4-(dimethylamino)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-[[4-(dimethylamino)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 7051807 |
| Molecular Formula | C27H28F3N3O2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | (1R,9S)-11-[[4-(dimethylamino)phenyl]methyl]-3-[4-(trifluoromethoxy)phenyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CN(C)c1ccc(CN2C[C@@H]3C[C@H](C2)c2c(-c4ccc(OC(F)(F)F)cc4)ccc(=O)n2C3)cc1 |
| InChI | InChI=1S/C27H28F3N3O2/c1-31(2)22-7-3-18(4-8-22)14-32-15-19-13-21(17-32)26-24(11-12-25(34)33(26)16-19)20-5-9-23(10-6-20)35-27(28,29)30/h3-12,19,21H,13-17H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | JGMVQQVXNKKSDM-PZJWPPBQSA-N |
| XLogP | 5.10 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|