C7H8INO2S2 — CID 70518269
2-[2-(iodomethylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 70518269) has the molecular formula C7H8INO2S2 and a molecular weight of 329.18 g/mol. Its IUPAC name is 2-[2-(iodomethylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(iodomethylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 70518269 |
| Molecular Formula | C7H8INO2S2 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.90 |
| IUPAC Name | 2-[2-(iodomethylsulfanyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | Cc1nc(SCI)sc1CC(=O)O |
| InChI | InChI=1S/C7H8INO2S2/c1-4-5(2-6(10)11)13-7(9-4)12-3-8/h2-3H2,1H3,(H,10,11) |
| InChIKey | OAZULGNDAJWISW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|