About 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine (PubChem CID 70518337) has the molecular formula C23H30N4O2
and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine |
| PubChem CID | 70518337 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine |
| SMILES | CC(C)c1ccc(N)cc1N.COc1cc(-c2ccc(N)c(OC)c2)ccc1N |
| InChI | InChI=1S/C14H16N2O2.C9H14N2/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-6(2)8-4-3-7(10)5-9(8)11/h3-8H,15-16H2,1-2H3;3-6H,10-11H2,1-2H3 |
| InChIKey | XFFRRBLXNZIHSE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine?
The IUPAC name of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine (CID 70518337) is 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine.
What is the SMILES notation for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine?
The canonical SMILES for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine is CC(C)c1ccc(N)cc1N.COc1cc(-c2ccc(N)c(OC)c2)ccc1N.
What is the InChIKey of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine?
The InChIKey is XFFRRBLXNZIHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2.C9H14N2/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-6(2)8-4-3-7(10)5-9(8)11/h3-8H,15-16H2,1-2H3;3-6H,10-11H2,1-2H3.
What are the key properties of 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine?
4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine has a molecular weight of 394.52 g/mol, XLogP of 4.51, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline;4-propan-2-ylbenzene-1,3-diamine is sourced from PubChem (CID 70518337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).