C47H47O9P — CID 70518950
[(3S)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] diethyl phosphate (PubChem CID 70518950) has the molecular formula C47H47O9P and a molecular weight of 786.86 g/mol. Its IUPAC name is [(3S)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] diethyl phosphate.
| Compound Name | [(3S)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] diethyl phosphate |
|---|---|
| PubChem CID | 70518950 |
| Molecular Formula | C47H47O9P |
| Molecular Weight | 786.86 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | [(3S)-2-[3,4-bis(phenylmethoxy)phenyl]-5,7-bis(phenylmethoxy)-3,4-dihydro-2H-chromen-3-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@H]1Cc2c(OCc3ccccc3)cc(OCc3ccccc3)cc2OC1c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C47H47O9P/c1-3-53-57(48,54-4-2)56-46-30-41-43(51-33-37-21-13-7-14-22-37)28-40(49-31-35-17-9-5-10-18-35)29-44(41)55-47(46)39-25-26-42(50-32-36-19-11-6-12-20-36)45(27-39)52-34-38-23-15-8-16-24-38/h5-29,46-47H,3-4,30-34H2,1-2H3/t46-,47?/m0/s1 |
| InChIKey | DWAWTPNDWWHKTI-XTCXTYGJSA-N |
| XLogP | 11.25 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.86 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|