C15H21Cl2FN2O3 — CID 70519225
1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]octan-2-yl acetate (PubChem CID 70519225) has the molecular formula C15H21Cl2FN2O3 and a molecular weight of 367.25 g/mol. Its IUPAC name is 1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]octan-2-yl acetate.
| Compound Name | 1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]octan-2-yl acetate |
|---|---|
| PubChem CID | 70519225 |
| Molecular Formula | C15H21Cl2FN2O3 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]octan-2-yl acetate |
| SMILES | CCCCCCC(COc1nc(F)c(Cl)c(N)c1Cl)OC(C)=O |
| InChI | InChI=1S/C15H21Cl2FN2O3/c1-3-4-5-6-7-10(23-9(2)21)8-22-15-12(17)13(19)11(16)14(18)20-15/h10H,3-8H2,1-2H3,(H2,19,20) |
| InChIKey | YZTNORNKZOHXCX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|