C19H33NO — CID 70519923
(3S,8R,9S,10S,13S,14S)-14-amino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 70519923) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (3S,8R,9S,10S,13S,14S)-14-amino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10S,13S,14S)-14-amino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70519923 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (3S,8R,9S,10S,13S,14S)-14-amino-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]12CCC[C@]1(N)[C@@H]1CCC3C[C@@H](O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H33NO/c1-17-8-3-9-19(17,20)16-5-4-13-12-14(21)6-11-18(13,2)15(16)7-10-17/h13-16,21H,3-12,20H2,1-2H3/t13?,14-,15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | CLOJODIRHUYCQH-NMXPSGJLSA-N |
| XLogP | 3.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |