About (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol (PubChem CID 70519997) has the molecular formula C13H17NO7
and a molecular weight of 299.28 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol.
Molecular Properties
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol |
| PubChem CID | 70519997 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol |
| SMILES | CNc1ccc(O)cc1.O=C1O[C@H]([C@@H](O)CO)C(O)=C1O |
| InChI | InChI=1S/C7H9NO.C6H8O6/c1-8-6-2-4-7(9)5-3-6;7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,8-9H,1H3;2,5,7-10H,1H2/t;2-,5+/m.0/s1 |
| InChIKey | LELOSUUWMPCMEY-MGMRMFRLSA-N |
| XLogP | 0.03 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol?
The IUPAC name of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol (CID 70519997) is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol.
What is the SMILES notation for (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol?
The canonical SMILES for (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol is CNc1ccc(O)cc1.O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.
What is the InChIKey of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol?
The InChIKey is LELOSUUWMPCMEY-MGMRMFRLSA-N. The full InChI is InChI=1S/C7H9NO.C6H8O6/c1-8-6-2-4-7(9)5-3-6;7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,8-9H,1H3;2,5,7-10H,1H2/t;2-,5+/m.0/s1.
What are the key properties of (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol?
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol has a molecular weight of 299.28 g/mol, XLogP of 0.03, 3 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;4-(methylamino)phenol is sourced from PubChem (CID 70519997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).