C26H40O3 — CID 70520296
(2R,8S,9S,10R,13S,14S,17S)-2,4,4,10,13-pentamethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70520296) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (2R,8S,9S,10R,13S,14S,17S)-2,4,4,10,13-pentamethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2R,8S,9S,10R,13S,14S,17S)-2,4,4,10,13-pentamethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70520296 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (2R,8S,9S,10R,13S,14S,17S)-2,4,4,10,13-pentamethyl-17-(2-methyl-1,3-dioxolan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C5(C)OCCO5)[C@@]4(C)CC[C@@H]32)C(C)(C)C1=O |
| InChI | InChI=1S/C26H40O3/c1-16-15-25(5)19-11-12-24(4)18(8-10-21(24)26(6)28-13-14-29-26)17(19)7-9-20(25)23(2,3)22(16)27/h9,16-19,21H,7-8,10-15H2,1-6H3/t16-,17+,18+,19+,21+,24+,25-/m1/s1 |
| InChIKey | KWCWQHZBKQITQB-NXVBGXGWSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|