About 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol
1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol (PubChem CID 70520367) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol.
Molecular Properties
| Compound Name | 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol |
| PubChem CID | 70520367 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol |
| SMILES | CCC(O)C(C)=CC1CC2C(C)=CC1CC2(C)CC |
| InChI | InChI=1S/C18H30O/c1-6-17(19)13(4)9-14-10-16-12(3)8-15(14)11-18(16,5)7-2/h8-9,14-17,19H,6-7,10-11H2,1-5H3 |
| InChIKey | QAHLIKOKHYIMFO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol?
The IUPAC name of 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol (CID 70520367) is 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol.
What is the SMILES notation for 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol?
The canonical SMILES for 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol is CCC(O)C(C)=CC1CC2C(C)=CC1CC2(C)CC.
What is the InChIKey of 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol?
The InChIKey is QAHLIKOKHYIMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-6-17(19)13(4)9-14-10-16-12(3)8-15(14)11-18(16,5)7-2/h8-9,14-17,19H,6-7,10-11H2,1-5H3.
What are the key properties of 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol?
1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol has a molecular weight of 262.44 g/mol, XLogP of 4.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-ethyl-5,8-dimethyl-2-bicyclo[2.2.2]oct-5-enyl)-2-methylpent-1-en-3-ol is sourced from PubChem (CID 70520367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).