About 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile
3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile (PubChem CID 70520521) has the molecular formula C10H5BrCl2N4
and a molecular weight of 331.99 g/mol. Its IUPAC name is 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile |
| PubChem CID | 70520521 |
| Molecular Formula | C10H5BrCl2N4 |
| Molecular Weight | 331.99 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)n[nH]c1-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C10H5BrCl2N4/c11-6-2-1-4(7(12)8(6)13)9-5(3-14)10(15)17-16-9/h1-2H,(H3,15,16,17) |
| InChIKey | XVOXUYHFLNSNKJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.99 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile?
The IUPAC name of 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile (CID 70520521) is 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile.
What is the SMILES notation for 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile?
The canonical SMILES for 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile is N#Cc1c(N)n[nH]c1-c1ccc(Br)c(Cl)c1Cl.
What is the InChIKey of 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile?
The InChIKey is XVOXUYHFLNSNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrCl2N4/c11-6-2-1-4(7(12)8(6)13)9-5(3-14)10(15)17-16-9/h1-2H,(H3,15,16,17).
What are the key properties of 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile?
3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile has a molecular weight of 331.99 g/mol, XLogP of 3.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(4-bromo-2,3-dichlorophenyl)-1H-pyrazole-4-carbonitrile is sourced from PubChem (CID 70520521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).