C10H12Cl3HgN2O3S+ — CID 70520577
[3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanylmercury(1+) (PubChem CID 70520577) has the molecular formula C10H12Cl3HgN2O3S+ and a molecular weight of 547.23 g/mol. Its IUPAC name is [3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanylmercury(1+).
| Compound Name | [3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanylmercury(1+) |
|---|---|
| PubChem CID | 70520577 |
| Molecular Formula | C10H12Cl3HgN2O3S+ |
| Molecular Weight | 547.23 g/mol |
| Exact Mass | 546.93 |
| IUPAC Name | [3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanylmercury(1+) |
| SMILES | C=C(C)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C(N)C1S[Hg+] |
| InChI | InChI=1S/C10H13Cl3N2O3S.Hg/c1-4(2)6(9(17)18-3-10(11,12)13)15-7(16)5(14)8(15)19;/h5-6,8,19H,1,3,14H2,2H3;/q;+2/p-1 |
| InChIKey | XTEPOKVJTSZJMF-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|