C21H23N — CID 70520636
2-(7-hexyl-7-methyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl)benzonitrile (PubChem CID 70520636) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(7-hexyl-7-methyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl)benzonitrile.
| Compound Name | 2-(7-hexyl-7-methyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl)benzonitrile |
|---|---|
| PubChem CID | 70520636 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-(7-hexyl-7-methyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl)benzonitrile |
| SMILES | CCCCCCC1(C)c2cccc(-c3ccccc3C#N)c21 |
| InChI | InChI=1S/C21H23N/c1-3-4-5-8-14-21(2)19-13-9-12-18(20(19)21)17-11-7-6-10-16(17)15-22/h6-7,9-13H,3-5,8,14H2,1-2H3 |
| InChIKey | RDLPOJMYIAEYEZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|