About [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate
[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate (PubChem CID 70520741) has the molecular formula C35H49FO3
and a molecular weight of 536.77 g/mol. Its IUPAC name is [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate.
Molecular Properties
| Compound Name | [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate |
| PubChem CID | 70520741 |
| Molecular Formula | C35H49FO3 |
| Molecular Weight | 536.77 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate |
| SMILES | CCCCCC1CCC(OC(=O)Oc2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3F)cc2)CC1 |
| InChI | InChI=1S/C35H49FO3/c1-3-5-7-9-26-11-15-28(16-12-26)30-19-24-33(34(36)25-30)29-17-22-32(23-18-29)39-35(37)38-31-20-13-27(14-21-31)10-8-6-4-2/h17-19,22-28,31H,3-16,20-21H2,1-2H3 |
| InChIKey | REMKVOQRXJNBOF-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.77 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate?
The IUPAC name of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate (CID 70520741) is [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate.
What is the SMILES notation for [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate?
The canonical SMILES for [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate is CCCCCC1CCC(OC(=O)Oc2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3F)cc2)CC1.
What is the InChIKey of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate?
The InChIKey is REMKVOQRXJNBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H49FO3/c1-3-5-7-9-26-11-15-28(16-12-26)30-19-24-33(34(36)25-30)29-17-22-32(23-18-29)39-35(37)38-31-20-13-27(14-21-31)10-8-6-4-2/h17-19,22-28,31H,3-16,20-21H2,1-2H3.
What are the key properties of [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate?
[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate has a molecular weight of 536.77 g/mol, XLogP of 11.00, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl] (4-pentylcyclohexyl) carbonate is sourced from PubChem (CID 70520741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).