C20H33F2N3 — CID 70520828
4-(4,5-dipentyl-1H-imidazol-2-yl)-3,5-difluorohepta-1,6-dien-4-amine (PubChem CID 70520828) has the molecular formula C20H33F2N3 and a molecular weight of 353.50 g/mol. Its IUPAC name is 4-(4,5-dipentyl-1H-imidazol-2-yl)-3,5-difluorohepta-1,6-dien-4-amine.
| Compound Name | 4-(4,5-dipentyl-1H-imidazol-2-yl)-3,5-difluorohepta-1,6-dien-4-amine |
|---|---|
| PubChem CID | 70520828 |
| Molecular Formula | C20H33F2N3 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 4-(4,5-dipentyl-1H-imidazol-2-yl)-3,5-difluorohepta-1,6-dien-4-amine |
| SMILES | C=CC(F)C(N)(c1nc(CCCCC)c(CCCCC)[nH]1)C(F)C=C |
| InChI | InChI=1S/C20H33F2N3/c1-5-9-11-13-15-16(14-12-10-6-2)25-19(24-15)20(23,17(21)7-3)18(22)8-4/h7-8,17-18H,3-6,9-14,23H2,1-2H3,(H,24,25) |
| InChIKey | IJQRNFBZQPJKQF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|