C20H21F3N2O5 — CID 70520881
2-[4-[2-nitro-4-(2,2,2-trifluoroethyl)anilino]phenoxy]hexanoic acid (PubChem CID 70520881) has the molecular formula C20H21F3N2O5 and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-[4-[2-nitro-4-(2,2,2-trifluoroethyl)anilino]phenoxy]hexanoic acid.
| Compound Name | 2-[4-[2-nitro-4-(2,2,2-trifluoroethyl)anilino]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 70520881 |
| Molecular Formula | C20H21F3N2O5 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[4-[2-nitro-4-(2,2,2-trifluoroethyl)anilino]phenoxy]hexanoic acid |
| SMILES | CCCCC(Oc1ccc(Nc2ccc(CC(F)(F)F)cc2[N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C20H21F3N2O5/c1-2-3-4-18(19(26)27)30-15-8-6-14(7-9-15)24-16-10-5-13(12-20(21,22)23)11-17(16)25(28)29/h5-11,18,24H,2-4,12H2,1H3,(H,26,27) |
| InChIKey | QNPBKHUXQPFOCS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|