C13H20N2 — CID 70521654
2,5,6-tris(prop-2-enyl)-1,2,5,6-tetrahydropyrimidine (PubChem CID 70521654) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2,5,6-tris(prop-2-enyl)-1,2,5,6-tetrahydropyrimidine.
| Compound Name | 2,5,6-tris(prop-2-enyl)-1,2,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 70521654 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2,5,6-tris(prop-2-enyl)-1,2,5,6-tetrahydropyrimidine |
| SMILES | C=CCC1N=CC(CC=C)C(CC=C)N1 |
| InChI | InChI=1S/C13H20N2/c1-4-7-11-10-14-13(9-6-3)15-12(11)8-5-2/h4-6,10-13,15H,1-3,7-9H2 |
| InChIKey | ITZLWARZBUNIRY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|